C13H11BrN6 — CID 5328318
N-(3-bromophenyl)-7-hydrazinylpyrido[4,3-d]pyrimidin-4-amine (PubChem CID 5328318) has the molecular formula C13H11BrN6 and a molecular weight of 331.18 g/mol. Its IUPAC name is N-(3-bromophenyl)-7-hydrazinylpyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-7-hydrazinylpyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5328318 |
| Molecular Formula | C13H11BrN6 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-(3-bromophenyl)-7-hydrazinylpyrido[4,3-d]pyrimidin-4-amine |
| SMILES | NNc1cc2ncnc(Nc3cccc(Br)c3)c2cn1 |
| InChI | InChI=1S/C13H11BrN6/c14-8-2-1-3-9(4-8)19-13-10-6-16-12(20-15)5-11(10)17-7-18-13/h1-7H,15H2,(H,16,20)(H,17,18,19) |
| InChIKey | XKJIVVHNSBAGCH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|