C18H19BrN4 — CID 152645355
4-N-(3-bromophenyl)-6-N-butan-2-ylquinazoline-4,6-diamine (PubChem CID 152645355) has the molecular formula C18H19BrN4 and a molecular weight of 371.28 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-N-butan-2-ylquinazoline-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)-6-N-butan-2-ylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 152645355 |
| Molecular Formula | C18H19BrN4 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-N-butan-2-ylquinazoline-4,6-diamine |
| SMILES | CCC(C)Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C18H19BrN4/c1-3-12(2)22-15-7-8-17-16(10-15)18(21-11-20-17)23-14-6-4-5-13(19)9-14/h4-12,22H,3H2,1-2H3,(H,20,21,23) |
| InChIKey | ZGKSEODDSSFPPF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |