C25H27IN4O2 — CID 162127082
(Z)-9-(dimethylamino)-1-[4-(3-iodoanilino)quinazolin-6-yl]non-3-ene-2,5-dione (PubChem CID 162127082) has the molecular formula C25H27IN4O2 and a molecular weight of 542.42 g/mol. Its IUPAC name is (Z)-9-(dimethylamino)-1-[4-(3-iodoanilino)quinazolin-6-yl]non-3-ene-2,5-dione.
| Compound Name | (Z)-9-(dimethylamino)-1-[4-(3-iodoanilino)quinazolin-6-yl]non-3-ene-2,5-dione |
|---|---|
| PubChem CID | 162127082 |
| Molecular Formula | C25H27IN4O2 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | (Z)-9-(dimethylamino)-1-[4-(3-iodoanilino)quinazolin-6-yl]non-3-ene-2,5-dione |
| SMILES | CN(C)CCCCC(=O)/C=C\C(=O)Cc1ccc2ncnc(Nc3cccc(I)c3)c2c1 |
| InChI | InChI=1S/C25H27IN4O2/c1-30(2)13-4-3-8-21(31)10-11-22(32)14-18-9-12-24-23(15-18)25(28-17-27-24)29-20-7-5-6-19(26)16-20/h5-7,9-12,15-17H,3-4,8,13-14H2,1-2H3,(H,27,28,29)/b11-10- |
| InChIKey | ZIEDSUWVIJQTJX-KHPPLWFESA-N |
| XLogP | 4.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|