C19H19ClN6O2 — CID 10200918
1-(2-chloroethyl)-3-methyl-3-[4-(3-methylanilino)quinazolin-6-yl]-1-nitrosourea (PubChem CID 10200918) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-methyl-3-[4-(3-methylanilino)quinazolin-6-yl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-methyl-3-[4-(3-methylanilino)quinazolin-6-yl]-1-nitrosourea |
|---|---|
| PubChem CID | 10200918 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-(2-chloroethyl)-3-methyl-3-[4-(3-methylanilino)quinazolin-6-yl]-1-nitrosourea |
| SMILES | Cc1cccc(Nc2ncnc3ccc(N(C)C(=O)N(CCCl)N=O)cc23)c1 |
| InChI | InChI=1S/C19H19ClN6O2/c1-13-4-3-5-14(10-13)23-18-16-11-15(6-7-17(16)21-12-22-18)25(2)19(27)26(24-28)9-8-20/h3-7,10-12H,8-9H2,1-2H3,(H,21,22,23) |
| InChIKey | NFRDLORGBPIOJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|