C25H22BrCl2FN6O — CID 56680549
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-bromo-4-fluoroanilino)quinazolin-6-yl]urea (PubChem CID 56680549) has the molecular formula C25H22BrCl2FN6O and a molecular weight of 592.30 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-bromo-4-fluoroanilino)quinazolin-6-yl]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-bromo-4-fluoroanilino)quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 56680549 |
| Molecular Formula | C25H22BrCl2FN6O |
| Molecular Weight | 592.30 g/mol |
| Exact Mass | 590.04 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-bromo-4-fluoroanilino)quinazolin-6-yl]urea |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)Nc1ccc2ncnc(Nc3ccc(F)c(Br)c3)c2c1 |
| InChI | InChI=1S/C25H22BrCl2FN6O/c26-21-14-18(3-7-22(21)29)32-24-20-13-17(4-8-23(20)30-15-31-24)34-25(36)33-16-1-5-19(6-2-16)35(11-9-27)12-10-28/h1-8,13-15H,9-12H2,(H,30,31,32)(H2,33,34,36) |
| InChIKey | DFZKNEISARNMDG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.30 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|