C23H18BrN5O3 — CID 175738584
2-[2-[[4-(4-bromoanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide (PubChem CID 175738584) has the molecular formula C23H18BrN5O3 and a molecular weight of 492.33 g/mol. Its IUPAC name is 2-[2-[[4-(4-bromoanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide.
| Compound Name | 2-[2-[[4-(4-bromoanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 175738584 |
| Molecular Formula | C23H18BrN5O3 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[2-[[4-(4-bromoanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
| SMILES | O=C(Cc1ccccc1C(=O)NO)Nc1ccc2ncnc(Nc3ccc(Br)cc3)c2c1 |
| InChI | InChI=1S/C23H18BrN5O3/c24-15-5-7-16(8-6-15)28-22-19-12-17(9-10-20(19)25-13-26-22)27-21(30)11-14-3-1-2-4-18(14)23(31)29-32/h1-10,12-13,32H,11H2,(H,27,30)(H,29,31)(H,25,26,28) |
| InChIKey | BKCKRGXHBWAMKI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|