C23H18FN5O3 — CID 175520373
4-[2-[[4-(4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide (PubChem CID 175520373) has the molecular formula C23H18FN5O3 and a molecular weight of 431.43 g/mol. Its IUPAC name is 4-[2-[[4-(4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide.
| Compound Name | 4-[2-[[4-(4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 175520373 |
| Molecular Formula | C23H18FN5O3 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-[2-[[4-(4-fluoroanilino)quinazolin-6-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
| SMILES | O=C(Cc1ccc(C(=O)NO)cc1)Nc1ccc2ncnc(Nc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C23H18FN5O3/c24-16-5-7-17(8-6-16)28-22-19-12-18(9-10-20(19)25-13-26-22)27-21(30)11-14-1-3-15(4-2-14)23(31)29-32/h1-10,12-13,32H,11H2,(H,27,30)(H,29,31)(H,25,26,28) |
| InChIKey | ZGJQBIDDLOCQAF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|