C27H32BrN5O5 — CID 22270179
tert-butyl 4-[3-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxypropyl]piperidine-1-carboxylate (PubChem CID 22270179) has the molecular formula C27H32BrN5O5 and a molecular weight of 586.49 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22270179 |
| Molecular Formula | C27H32BrN5O5 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | tert-butyl 4-[3-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxypropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCOc2cc3ncnc(Nc4cccc(Br)c4)c3cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H32BrN5O5/c1-27(2,3)38-26(34)32-11-9-18(10-12-32)6-5-13-37-24-16-22-21(15-23(24)33(35)36)25(30-17-29-22)31-20-8-4-7-19(28)14-20/h4,7-8,14-18H,5-6,9-13H2,1-3H3,(H,29,30,31) |
| InChIKey | PGZUJIZSHJFJIZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|