C29H33BrN6O5 — CID 22270142
ethyl 1-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl]pyrrolidine-2-carboxylate (PubChem CID 22270142) has the molecular formula C29H33BrN6O5 and a molecular weight of 625.52 g/mol. Its IUPAC name is ethyl 1-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22270142 |
| Molecular Formula | C29H33BrN6O5 |
| Molecular Weight | 625.52 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | ethyl 1-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1CCCNC(=O)/C=C/C(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OC |
| InChI | InChI=1S/C29H33BrN6O5/c1-3-41-29(39)24-9-5-13-36(24)14-6-12-31-26(37)10-11-27(38)35-23-16-21-22(17-25(23)40-2)32-18-33-28(21)34-20-8-4-7-19(30)15-20/h4,7-8,10-11,15-18,24H,3,5-6,9,12-14H2,1-2H3,(H,31,37)(H,35,38)(H,32,33,34)/b11-10+ |
| InChIKey | BSDBHTIWRIDLAE-ZHACJKMWSA-N |
| XLogP | 4.17 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|