C28H32BrN5O4 — CID 70204035
cyclohexyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate (PubChem CID 70204035) has the molecular formula C28H32BrN5O4 and a molecular weight of 582.50 g/mol. Its IUPAC name is cyclohexyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate.
| Compound Name | cyclohexyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate |
|---|---|
| PubChem CID | 70204035 |
| Molecular Formula | C28H32BrN5O4 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | cyclohexyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate |
| SMILES | COc1cc2ncnc(Nc3cccc(Br)c3)c2cc1NCC=CC(=O)N(C)CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C28H32BrN5O4/c1-34(17-27(36)38-21-10-4-3-5-11-21)26(35)12-7-13-30-24-15-22-23(16-25(24)37-2)31-18-32-28(22)33-20-9-6-8-19(29)14-20/h6-9,12,14-16,18,21,30H,3-5,10-11,13,17H2,1-2H3,(H,31,32,33) |
| InChIKey | ARQSAMXOIHCPQZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|