C28H28FN5O2 — CID 118857941
(E)-4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)-7-[2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]but-2-enamide (PubChem CID 118857941) has the molecular formula C28H28FN5O2 and a molecular weight of 485.56 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)-7-[2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)-7-[2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 118857941 |
| Molecular Formula | C28H28FN5O2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)-7-[2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]but-2-enamide |
| SMILES | Cc1cc(Nc2ncnc3cc(C#CC4[C@H]5COC[C@@H]45)c(NC(=O)/C=C/CN(C)C)cc23)ccc1F |
| InChI | InChI=1S/C28H28FN5O2/c1-17-11-19(7-9-24(17)29)32-28-21-13-25(33-27(35)5-4-10-34(2)3)18(12-26(21)30-16-31-28)6-8-20-22-14-36-15-23(20)22/h4-5,7,9,11-13,16,20,22-23H,10,14-15H2,1-3H3,(H,33,35)(H,30,31,32)/b5-4+/t20?,22-,23+ |
| InChIKey | SMJHZJKENSUXJM-AKDMAJJWSA-N |
| XLogP | 4.12 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|