C28H27ClFN5O2 — CID 134527521
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-[(5S,6R)-1-methyl-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 134527521) has the molecular formula C28H27ClFN5O2 and a molecular weight of 520.01 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-[(5S,6R)-1-methyl-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-[(5S,6R)-1-methyl-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 134527521 |
| Molecular Formula | C28H27ClFN5O2 |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-[(5S,6R)-1-methyl-3-oxabicyclo[3.1.0]hexan-6-yl]ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1C#C[C@H]1[C@@H]2COCC12C |
| InChI | InChI=1S/C28H27ClFN5O2/c1-28-15-37-14-21(28)20(28)8-6-17-11-25-19(13-24(17)34-26(36)5-4-10-35(2)3)27(32-16-31-25)33-18-7-9-23(30)22(29)12-18/h4-5,7,9,11-13,16,20-21H,10,14-15H2,1-3H3,(H,34,36)(H,31,32,33)/b5-4+/t20-,21-,28?/m0/s1 |
| InChIKey | OKFOMELUJOCZRP-IRIMPHICSA-N |
| XLogP | 4.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|