C30H34FN7O — CID 146609953
(E)-N-[4-[3-butyl-4-[(3-fluorophenyl)methylamino]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 146609953) has the molecular formula C30H34FN7O and a molecular weight of 527.65 g/mol. Its IUPAC name is (E)-N-[4-[3-butyl-4-[(3-fluorophenyl)methylamino]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-butyl-4-[(3-fluorophenyl)methylamino]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 146609953 |
| Molecular Formula | C30H34FN7O |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (E)-N-[4-[3-butyl-4-[(3-fluorophenyl)methylamino]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCCCc1cc(Nc2ncnc3cnc(NC(=O)/C=C/CN(C)C)cc23)ccc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C30H34FN7O/c1-4-5-9-22-16-24(12-13-26(22)32-18-21-8-6-10-23(31)15-21)36-30-25-17-28(33-19-27(25)34-20-35-30)37-29(39)11-7-14-38(2)3/h6-8,10-13,15-17,19-20,32H,4-5,9,14,18H2,1-3H3,(H,33,37,39)(H,34,35,36)/b11-7+ |
| InChIKey | JXPHUQBHCJUKPG-YRNVUSSQSA-N |
| XLogP | 5.92 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|