C23H18FN5O3 — CID 69053025
N-[4-[4-(3-fluorophenoxy)-3-methoxyanilino]pyrido[3,4-d]pyrimidin-6-yl]prop-2-enamide (PubChem CID 69053025) has the molecular formula C23H18FN5O3 and a molecular weight of 431.43 g/mol. Its IUPAC name is N-[4-[4-(3-fluorophenoxy)-3-methoxyanilino]pyrido[3,4-d]pyrimidin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[4-(3-fluorophenoxy)-3-methoxyanilino]pyrido[3,4-d]pyrimidin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69053025 |
| Molecular Formula | C23H18FN5O3 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[4-[4-(3-fluorophenoxy)-3-methoxyanilino]pyrido[3,4-d]pyrimidin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(Oc4cccc(F)c4)c(OC)c3)ncnc2cn1 |
| InChI | InChI=1S/C23H18FN5O3/c1-3-22(30)29-21-11-17-18(12-25-21)26-13-27-23(17)28-15-7-8-19(20(10-15)31-2)32-16-6-4-5-14(24)9-16/h3-13H,1H2,2H3,(H,25,29,30)(H,26,27,28) |
| InChIKey | JPVAMTWORVYWIH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|