C32H28ClFN4O4S — CID 159585060
1-[4-[3-chloro-4-[(3-fluorophenyl)methylamino]anilino]quinazolin-6-yl]but-3-en-2-one;4-methylbenzenesulfonic acid (PubChem CID 159585060) has the molecular formula C32H28ClFN4O4S and a molecular weight of 619.12 g/mol. Its IUPAC name is 1-[4-[3-chloro-4-[(3-fluorophenyl)methylamino]anilino]quinazolin-6-yl]but-3-en-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-[4-[3-chloro-4-[(3-fluorophenyl)methylamino]anilino]quinazolin-6-yl]but-3-en-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 159585060 |
| Molecular Formula | C32H28ClFN4O4S |
| Molecular Weight | 619.12 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 1-[4-[3-chloro-4-[(3-fluorophenyl)methylamino]anilino]quinazolin-6-yl]but-3-en-2-one;4-methylbenzenesulfonic acid |
| SMILES | C=CC(=O)Cc1ccc2ncnc(Nc3ccc(NCc4cccc(F)c4)c(Cl)c3)c2c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H20ClFN4O.C7H8O3S/c1-2-20(32)11-16-6-8-23-21(12-16)25(30-15-29-23)31-19-7-9-24(22(26)13-19)28-14-17-4-3-5-18(27)10-17;1-6-2-4-7(5-3-6)11(8,9)10/h2-10,12-13,15,28H,1,11,14H2,(H,29,30,31);2-5H,1H3,(H,8,9,10) |
| InChIKey | DJDMCTZNZKKVOH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.12 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|