C38H34ClFN4O7S2 — CID 56644742
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(1R)-2-methylsulfonyl-1-(prop-2-ynylamino)ethyl]furan-2-yl]quinazolin-4-amine;4-methylbenzenesulfonic acid (PubChem CID 56644742) has the molecular formula C38H34ClFN4O7S2 and a molecular weight of 777.30 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(1R)-2-methylsulfonyl-1-(prop-2-ynylamino)ethyl]furan-2-yl]quinazolin-4-amine;4-methylbenzenesulfonic acid.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(1R)-2-methylsulfonyl-1-(prop-2-ynylamino)ethyl]furan-2-yl]quinazolin-4-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 56644742 |
| Molecular Formula | C38H34ClFN4O7S2 |
| Molecular Weight | 777.30 g/mol |
| Exact Mass | 776.15 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(1R)-2-methylsulfonyl-1-(prop-2-ynylamino)ethyl]furan-2-yl]quinazolin-4-amine;4-methylbenzenesulfonic acid |
| SMILES | C#CCN[C@@H](CS(C)(=O)=O)c1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H26ClFN4O4S.C7H8O3S/c1-3-13-34-27(18-42(2,38)39)30-12-11-28(41-30)21-7-9-26-24(15-21)31(36-19-35-26)37-23-8-10-29(25(32)16-23)40-17-20-5-4-6-22(33)14-20;1-6-2-4-7(5-3-6)11(8,9)10/h1,4-12,14-16,19,27,34H,13,17-18H2,2H3,(H,35,36,37);2-5H,1H3,(H,8,9,10)/t27-;/m0./s1 |
| InChIKey | JALQZHFIRQNNAX-YCBFMBTMSA-N |
| XLogP | 7.56 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.30 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|