C21H24ClFN6OS — CID 90655161
(E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[3-(dimethylamino)propylamino]but-2-enamide (PubChem CID 90655161) has the molecular formula C21H24ClFN6OS and a molecular weight of 462.98 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[3-(dimethylamino)propylamino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[3-(dimethylamino)propylamino]but-2-enamide |
|---|---|
| PubChem CID | 90655161 |
| Molecular Formula | C21H24ClFN6OS |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[3-(dimethylamino)propylamino]but-2-enamide |
| SMILES | CN(C)CCCNC/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2s1 |
| InChI | InChI=1S/C21H24ClFN6OS/c1-29(2)10-4-9-24-8-3-5-18(30)28-19-12-15-20(25-13-26-21(15)31-19)27-14-6-7-17(23)16(22)11-14/h3,5-7,11-13,24H,4,8-10H2,1-2H3,(H,28,30)(H,25,26,27)/b5-3+ |
| InChIKey | AJCPVYIKALUFSW-HWKANZROSA-N |
| XLogP | 4.26 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|