C24H28ClFN4OS — CID 71025433
(E)-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]-6-(propylamino)hex-4-en-3-one (PubChem CID 71025433) has the molecular formula C24H28ClFN4OS and a molecular weight of 475.03 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]-6-(propylamino)hex-4-en-3-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]-6-(propylamino)hex-4-en-3-one |
|---|---|
| PubChem CID | 71025433 |
| Molecular Formula | C24H28ClFN4OS |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]-6-(propylamino)hex-4-en-3-one |
| SMILES | CCCNC/C=C/C(=O)CCc1sc2ncnc(Nc3ccc(F)c(Cl)c3)c2c1CCC |
| InChI | InChI=1S/C24H28ClFN4OS/c1-3-6-18-21(11-9-17(31)7-5-13-27-12-4-2)32-24-22(18)23(28-15-29-24)30-16-8-10-20(26)19(25)14-16/h5,7-8,10,14-15,27H,3-4,6,9,11-13H2,1-2H3,(H,28,29,30)/b7-5+ |
| InChIKey | JAGZDPHCQYUYCJ-FNORWQNLSA-N |
| XLogP | 6.24 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|