C19H15ClFN5S — CID 143192525
N-(3-chloro-4-fluorophenyl)-4-ethyl-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaen-11-amine (PubChem CID 143192525) has the molecular formula C19H15ClFN5S and a molecular weight of 399.88 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-ethyl-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaen-11-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-ethyl-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaen-11-amine |
|---|---|
| PubChem CID | 143192525 |
| Molecular Formula | C19H15ClFN5S |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-ethyl-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaen-11-amine |
| SMILES | CCn1cc2c(n1)CCc1c-2sc2ncnc(Nc3ccc(F)c(Cl)c3)c12 |
| InChI | InChI=1S/C19H15ClFN5S/c1-2-26-8-12-15(25-26)6-4-11-16-18(22-9-23-19(16)27-17(11)12)24-10-3-5-14(21)13(20)7-10/h3,5,7-9H,2,4,6H2,1H3,(H,22,23,24) |
| InChIKey | LXZGRUZYDVODLW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |