C19H16ClFN4OS — CID 67273682
4-(3-chloro-4-fluoroanilino)-8-(dimethylaminomethylidene)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidin-7-one (PubChem CID 67273682) has the molecular formula C19H16ClFN4OS and a molecular weight of 402.88 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-8-(dimethylaminomethylidene)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidin-7-one.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-8-(dimethylaminomethylidene)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 67273682 |
| Molecular Formula | C19H16ClFN4OS |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-8-(dimethylaminomethylidene)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidin-7-one |
| SMILES | CN(C)C=C1C(=O)CCc2c1sc1ncnc(Nc3ccc(F)c(Cl)c3)c21 |
| InChI | InChI=1S/C19H16ClFN4OS/c1-25(2)8-12-15(26)6-4-11-16-18(22-9-23-19(16)27-17(11)12)24-10-3-5-14(21)13(20)7-10/h3,5,7-9H,4,6H2,1-2H3,(H,22,23,24) |
| InChIKey | LBRKZYVHFIEIDQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|