C27H34ClFN4O3S — CID 70915432
(E)-6-[bis(2-methoxyethyl)amino]-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]hex-4-en-3-one (PubChem CID 70915432) has the molecular formula C27H34ClFN4O3S and a molecular weight of 549.11 g/mol. Its IUPAC name is (E)-6-[bis(2-methoxyethyl)amino]-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]hex-4-en-3-one.
| Compound Name | (E)-6-[bis(2-methoxyethyl)amino]-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]hex-4-en-3-one |
|---|---|
| PubChem CID | 70915432 |
| Molecular Formula | C27H34ClFN4O3S |
| Molecular Weight | 549.11 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (E)-6-[bis(2-methoxyethyl)amino]-1-[4-(3-chloro-4-fluoroanilino)-5-propylthieno[2,3-d]pyrimidin-6-yl]hex-4-en-3-one |
| SMILES | CCCc1c(CCC(=O)/C=C/CN(CCOC)CCOC)sc2ncnc(Nc3ccc(F)c(Cl)c3)c12 |
| InChI | InChI=1S/C27H34ClFN4O3S/c1-4-6-21-24(11-9-20(34)7-5-12-33(13-15-35-2)14-16-36-3)37-27-25(21)26(30-18-31-27)32-19-8-10-23(29)22(28)17-19/h5,7-8,10,17-18H,4,6,9,11-16H2,1-3H3,(H,30,31,32)/b7-5+ |
| InChIKey | GPFOEHHDAQLNPK-FNORWQNLSA-N |
| XLogP | 5.83 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.11 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|