C26H28ClFN4O2 — CID 142693643
1-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-(diethylamino)but-2-en-1-one (PubChem CID 142693643) has the molecular formula C26H28ClFN4O2 and a molecular weight of 482.99 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-(diethylamino)but-2-en-1-one.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-(diethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 142693643 |
| Molecular Formula | C26H28ClFN4O2 |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-(diethylamino)but-2-en-1-one |
| SMILES | CCN(CC)CC=CC(=O)c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1 |
| InChI | InChI=1S/C26H28ClFN4O2/c1-3-32(4-2)11-5-6-24(33)20-13-19-23(14-25(20)34-15-17-7-8-17)29-16-30-26(19)31-18-9-10-22(28)21(27)12-18/h5-6,9-10,12-14,16-17H,3-4,7-8,11,15H2,1-2H3,(H,29,30,31) |
| InChIKey | XFQMOIRKIOLYNO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|