C23H21ClFN5O2S — CID 86302307
(E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[(1R,4S)-6-oxo-2-azabicyclo[2.2.2]octan-2-yl]but-2-enamide (PubChem CID 86302307) has the molecular formula C23H21ClFN5O2S and a molecular weight of 485.97 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[(1R,4S)-6-oxo-2-azabicyclo[2.2.2]octan-2-yl]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[(1R,4S)-6-oxo-2-azabicyclo[2.2.2]octan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 86302307 |
| Molecular Formula | C23H21ClFN5O2S |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)thieno[2,3-d]pyrimidin-6-yl]-4-[(1R,4S)-6-oxo-2-azabicyclo[2.2.2]octan-2-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1C[C@H]2CC[C@@H]1C(=O)C2)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2s1 |
| InChI | InChI=1S/C23H21ClFN5O2S/c24-16-9-14(4-5-17(16)25)28-22-15-10-21(33-23(15)27-12-26-22)29-20(32)2-1-7-30-11-13-3-6-18(30)19(31)8-13/h1-2,4-5,9-10,12-13,18H,3,6-8,11H2,(H,29,32)(H,26,27,28)/b2-1+/t13-,18+/m0/s1 |
| InChIKey | WDQXCAKHPJSZET-PKFCRQPISA-N |
| XLogP | 4.78 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|