C23H22ClF2N5O2 — CID 71244629
(Z)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-2-fluoro-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-enamide (PubChem CID 71244629) has the molecular formula C23H22ClF2N5O2 and a molecular weight of 473.91 g/mol. Its IUPAC name is (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-2-fluoro-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-enamide.
| Compound Name | (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-2-fluoro-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71244629 |
| Molecular Formula | C23H22ClF2N5O2 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-2-fluoro-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C(F)=C/[C@@H]1CCCN1C |
| InChI | InChI=1S/C23H22ClF2N5O2/c1-31-7-3-4-14(31)9-18(26)23(32)30-20-10-15-19(11-21(20)33-2)27-12-28-22(15)29-13-5-6-17(25)16(24)8-13/h5-6,8-12,14H,3-4,7H2,1-2H3,(H,30,32)(H,27,28,29)/b18-9-/t14-/m0/s1 |
| InChIKey | HHTHPZQFJGXLEG-WXARJGPPSA-N |
| XLogP | 5.06 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|