C16H9ClF4N4O4S — CID 24743067
N-(3-chloro-4-fluorophenyl)-6-nitro-7-(2,2,2-trifluoroethylsulfonyl)quinazolin-4-amine (PubChem CID 24743067) has the molecular formula C16H9ClF4N4O4S and a molecular weight of 464.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-nitro-7-(2,2,2-trifluoroethylsulfonyl)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-nitro-7-(2,2,2-trifluoroethylsulfonyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 24743067 |
| Molecular Formula | C16H9ClF4N4O4S |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-nitro-7-(2,2,2-trifluoroethylsulfonyl)quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C16H9ClF4N4O4S/c17-10-3-8(1-2-11(10)18)24-15-9-4-13(25(26)27)14(5-12(9)22-7-23-15)30(28,29)6-16(19,20)21/h1-5,7H,6H2,(H,22,23,24) |
| InChIKey | OTGMFRIYTDYZHR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|