C17H12BrF2N5O4 — CID 69100728
N-[7-(2-aminoethoxy)-6-nitroquinazolin-4-yl]-4-bromo-2,3-difluorobenzamide (PubChem CID 69100728) has the molecular formula C17H12BrF2N5O4 and a molecular weight of 468.21 g/mol. Its IUPAC name is N-[7-(2-aminoethoxy)-6-nitroquinazolin-4-yl]-4-bromo-2,3-difluorobenzamide.
| Compound Name | N-[7-(2-aminoethoxy)-6-nitroquinazolin-4-yl]-4-bromo-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 69100728 |
| Molecular Formula | C17H12BrF2N5O4 |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | N-[7-(2-aminoethoxy)-6-nitroquinazolin-4-yl]-4-bromo-2,3-difluorobenzamide |
| SMILES | NCCOc1cc2ncnc(NC(=O)c3ccc(Br)c(F)c3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12BrF2N5O4/c18-10-2-1-8(14(19)15(10)20)17(26)24-16-9-5-12(25(27)28)13(29-4-3-21)6-11(9)22-7-23-16/h1-2,5-7H,3-4,21H2,(H,22,23,24,26) |
| InChIKey | YEYODCSIHLIKRR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|