C18H16Cl2FN5 — CID 166539801
N-(3,4-dichloro-2-fluorophenyl)-6-piperazin-1-ylquinazolin-4-amine (PubChem CID 166539801) has the molecular formula C18H16Cl2FN5 and a molecular weight of 392.27 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-6-piperazin-1-ylquinazolin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-6-piperazin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 166539801 |
| Molecular Formula | C18H16Cl2FN5 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-6-piperazin-1-ylquinazolin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc(N4CCNCC4)cc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl2FN5/c19-13-2-4-15(17(21)16(13)20)25-18-12-9-11(26-7-5-22-6-8-26)1-3-14(12)23-10-24-18/h1-4,9-10,22H,5-8H2,(H,23,24,25) |
| InChIKey | SXGKFDYMRKKOOZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|