C18H16Cl2FN5 — CID 166540129
N-(3,4-dichloro-2-fluorophenyl)-6-[(3R)-piperidin-3-yl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166540129) has the molecular formula C18H16Cl2FN5 and a molecular weight of 392.27 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-6-[(3R)-piperidin-3-yl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-6-[(3R)-piperidin-3-yl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166540129 |
| Molecular Formula | C18H16Cl2FN5 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-6-[(3R)-piperidin-3-yl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc([C@@H]4CCCNC4)nc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl2FN5/c19-11-3-4-13(16(21)15(11)20)26-18-17-14(23-9-24-18)6-5-12(25-17)10-2-1-7-22-8-10/h3-6,9-10,22H,1-2,7-8H2,(H,23,24,26)/t10-/m1/s1 |
| InChIKey | IUSRPOQYOMSTIA-SNVBAGLBSA-N |
| XLogP | 4.68 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|