C17H13Cl2FN4O2S — CID 156505140
methyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropanoate (PubChem CID 156505140) has the molecular formula C17H13Cl2FN4O2S and a molecular weight of 427.29 g/mol. Its IUPAC name is methyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 156505140 |
| Molecular Formula | C17H13Cl2FN4O2S |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | methyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCSc1ccc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C17H13Cl2FN4O2S/c1-26-13(25)6-7-27-12-5-4-11-16(24-12)17(22-8-21-11)23-10-3-2-9(18)14(19)15(10)20/h2-5,8H,6-7H2,1H3,(H,21,22,23) |
| InChIKey | WYYRYWDUKXERHA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|