C17H14Cl2FN5S — CID 156505237
N-(3,4-dichloro-2-fluorophenyl)-6-pyrrolidin-3-ylsulfanylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 156505237) has the molecular formula C17H14Cl2FN5S and a molecular weight of 410.31 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-6-pyrrolidin-3-ylsulfanylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-6-pyrrolidin-3-ylsulfanylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156505237 |
| Molecular Formula | C17H14Cl2FN5S |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-6-pyrrolidin-3-ylsulfanylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc(SC4CCNC4)nc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl2FN5S/c18-10-1-2-11(15(20)14(10)19)24-17-16-12(22-8-23-17)3-4-13(25-16)26-9-5-6-21-7-9/h1-4,8-9,21H,5-7H2,(H,22,23,24) |
| InChIKey | MPPWZHNNENXINN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|