C22H22Cl2FN5O2S — CID 156504863
tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpyrrolidine-1-carboxylate (PubChem CID 156504863) has the molecular formula C22H22Cl2FN5O2S and a molecular weight of 510.42 g/mol. Its IUPAC name is tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156504863 |
| Molecular Formula | C22H22Cl2FN5O2S |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3n2)C1 |
| InChI | InChI=1S/C22H22Cl2FN5O2S/c1-22(2,3)32-21(31)30-9-8-12(10-30)33-16-7-6-15-19(29-16)20(27-11-26-15)28-14-5-4-13(23)17(24)18(14)25/h4-7,11-12H,8-10H2,1-3H3,(H,26,27,28) |
| InChIKey | YKVQGAQJXYPGBD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|