C17H14Cl2FN5O — CID 156505188
6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 156505188) has the molecular formula C17H14Cl2FN5O and a molecular weight of 394.24 g/mol. Its IUPAC name is 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156505188 |
| Molecular Formula | C17H14Cl2FN5O |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2nc1OC1CNC1 |
| InChI | InChI=1S/C17H14Cl2FN5O/c1-8-4-12-15(25-17(8)26-9-5-21-6-9)16(23-7-22-12)24-11-3-2-10(18)13(19)14(11)20/h2-4,7,9,21H,5-6H2,1H3,(H,22,23,24) |
| InChIKey | WIBAELPSDWNSAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|