C18H16Cl2FN5O — CID 156797223
4-(3,4-dichloro-2-fluoroanilino)-6-[(3-methylazetidin-3-yl)methyl]pyrido[3,2-d]pyrimidin-7-ol (PubChem CID 156797223) has the molecular formula C18H16Cl2FN5O and a molecular weight of 408.26 g/mol. Its IUPAC name is 4-(3,4-dichloro-2-fluoroanilino)-6-[(3-methylazetidin-3-yl)methyl]pyrido[3,2-d]pyrimidin-7-ol.
| Compound Name | 4-(3,4-dichloro-2-fluoroanilino)-6-[(3-methylazetidin-3-yl)methyl]pyrido[3,2-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 156797223 |
| Molecular Formula | C18H16Cl2FN5O |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-(3,4-dichloro-2-fluoroanilino)-6-[(3-methylazetidin-3-yl)methyl]pyrido[3,2-d]pyrimidin-7-ol |
| SMILES | CC1(Cc2nc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2O)CNC1 |
| InChI | InChI=1S/C18H16Cl2FN5O/c1-18(6-22-7-18)5-12-13(27)4-11-16(25-12)17(24-8-23-11)26-10-3-2-9(19)14(20)15(10)21/h2-4,8,22,27H,5-7H2,1H3,(H,23,24,26) |
| InChIKey | OOMYTHHZQRNYMG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|