C24H25FN6O — CID 167244758
1-[3-[4-(3-ethyl-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 167244758) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-[3-[4-(3-ethyl-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(3-ethyl-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167244758 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[3-[4-(3-ethyl-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CCC1CN(c1ccc3ncnc(Nc4cccc(CC)c4F)c3n1)C2 |
| InChI | InChI=1S/C24H25FN6O/c1-3-15-6-5-7-18(22(15)25)28-24-23-19(26-14-27-24)10-11-20(29-23)30-12-16-8-9-17(13-30)31(16)21(32)4-2/h4-7,10-11,14,16-17H,2-3,8-9,12-13H2,1H3,(H,26,27,28) |
| InChIKey | DIBCJXXBSRNBSF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|