C21H18F2N6O — CID 166539327
1-[6-[4-(2,3-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-1,6-diazaspiro[3.3]heptan-1-yl]prop-2-en-1-one (PubChem CID 166539327) has the molecular formula C21H18F2N6O and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-[6-[4-(2,3-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-1,6-diazaspiro[3.3]heptan-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-(2,3-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-1,6-diazaspiro[3.3]heptan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166539327 |
| Molecular Formula | C21H18F2N6O |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[6-[4-(2,3-difluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-1,6-diazaspiro[3.3]heptan-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC12CN(c1ccc3ncnc(Nc4cccc(F)c4F)c3n1)C2 |
| InChI | InChI=1S/C21H18F2N6O/c1-2-17(30)29-9-8-21(29)10-28(11-21)16-7-6-15-19(27-16)20(25-12-24-15)26-14-5-3-4-13(22)18(14)23/h2-7,12H,1,8-11H2,(H,24,25,26) |
| InChIKey | VPDUYQSKNPFHAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|