C30H29N9O — CID 169133396
1-[7-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]-4,7-diazaspiro[2.5]octan-4-yl]prop-2-en-1-one (PubChem CID 169133396) has the molecular formula C30H29N9O and a molecular weight of 531.62 g/mol. Its IUPAC name is 1-[7-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]-4,7-diazaspiro[2.5]octan-4-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]-4,7-diazaspiro[2.5]octan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169133396 |
| Molecular Formula | C30H29N9O |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 1-[7-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]-4,7-diazaspiro[2.5]octan-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc3ncnc(Nc4ccc(Cc5ccn6ncnc6c5)c(C)c4)c3n2)CC12CC2 |
| InChI | InChI=1S/C30H29N9O/c1-3-27(40)38-13-12-37(17-30(38)9-10-30)25-7-6-24-28(36-25)29(33-18-31-24)35-23-5-4-22(20(2)14-23)15-21-8-11-39-26(16-21)32-19-34-39/h3-8,11,14,16,18-19H,1,9-10,12-13,15,17H2,2H3,(H,31,33,35) |
| InChIKey | RQONRBCATHOMGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|