C32H38N9O2+ — CID 169133411
tert-butyl 2,2-dimethyl-4-[4-[3-methyl-4-(3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]piperazine-1-carboxylate (PubChem CID 169133411) has the molecular formula C32H38N9O2+ and a molecular weight of 580.72 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[4-[3-methyl-4-(3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[4-[3-methyl-4-(3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169133411 |
| Molecular Formula | C32H38N9O2+ |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[4-[3-methyl-4-(3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-7-ylmethyl)anilino]pyrido[3,2-d]pyrimidin-6-yl]piperazine-1-carboxylate |
| SMILES | Cc1cc(Nc2ncnc3ccc(N4CCN(C(=O)OC(C)(C)C)C(C)(C)C4)nc23)ccc1Cc1cc[n+]2[nH]cnc2c1 |
| InChI | InChI=1S/C32H37N9O2/c1-21-15-24(8-7-23(21)16-22-11-12-41-27(17-22)34-20-36-41)37-29-28-25(33-19-35-29)9-10-26(38-28)39-13-14-40(32(5,6)18-39)30(42)43-31(2,3)4/h7-12,15,17,19-20H,13-14,16,18H2,1-6H3,(H,33,35,37)/p+1 |
| InChIKey | NHSLSWIGTDACLR-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|