C10H7Cl2FN4 — CID 80755046
4-N-(2,3-dichlorophenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 80755046) has the molecular formula C10H7Cl2FN4 and a molecular weight of 273.10 g/mol. Its IUPAC name is 4-N-(2,3-dichlorophenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3-dichlorophenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80755046 |
| Molecular Formula | C10H7Cl2FN4 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-N-(2,3-dichlorophenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Nc1ncc(F)c(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H7Cl2FN4/c11-5-2-1-3-7(8(5)12)16-9-6(13)4-15-10(14)17-9/h1-4H,(H3,14,15,16,17) |
| InChIKey | KPRRRKFLKGXFDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |