C11H8Cl3N3 — CID 115473651
6-chloro-2-N-(2,3-dichlorophenyl)pyridine-2,3-diamine (PubChem CID 115473651) has the molecular formula C11H8Cl3N3 and a molecular weight of 288.56 g/mol. Its IUPAC name is 6-chloro-2-N-(2,3-dichlorophenyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(2,3-dichlorophenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115473651 |
| Molecular Formula | C11H8Cl3N3 |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 6-chloro-2-N-(2,3-dichlorophenyl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl3N3/c12-6-2-1-3-8(10(6)14)16-11-7(15)4-5-9(13)17-11/h1-5H,15H2,(H,16,17) |
| InChIKey | YZOBKBRFMVKNSF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|