C26H30ClN3O — CID 176997439
1-[3-(3-chloro-2-methylphenyl)-3-[(1,3,3-trimethyl-2H-indol-6-yl)amino]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 176997439) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is 1-[3-(3-chloro-2-methylphenyl)-3-[(1,3,3-trimethyl-2H-indol-6-yl)amino]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-(3-chloro-2-methylphenyl)-3-[(1,3,3-trimethyl-2H-indol-6-yl)amino]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 176997439 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-[3-(3-chloro-2-methylphenyl)-3-[(1,3,3-trimethyl-2H-indol-6-yl)amino]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC(Nc2ccc3c(c2)N(C)CC3(C)C)(c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C26H30ClN3O/c1-6-8-24(31)30-14-13-26(17-30,20-9-7-10-22(27)18(20)2)28-19-11-12-21-23(15-19)29(5)16-25(21,3)4/h7,9-12,15,28H,13-14,16-17H2,1-5H3 |
| InChIKey | VEYJBOKSBUYSIR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|