C24H30N2O — CID 68873887
3-(4-tert-butylphenyl)-N-(1,3,3-trimethyl-2H-indol-6-yl)prop-2-enamide (PubChem CID 68873887) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(1,3,3-trimethyl-2H-indol-6-yl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(1,3,3-trimethyl-2H-indol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68873887 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(1,3,3-trimethyl-2H-indol-6-yl)prop-2-enamide |
| SMILES | CN1CC(C)(C)c2ccc(NC(=O)C=Cc3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C24H30N2O/c1-23(2,3)18-10-7-17(8-11-18)9-14-22(27)25-19-12-13-20-21(15-19)26(6)16-24(20,4)5/h7-15H,16H2,1-6H3,(H,25,27) |
| InChIKey | LONLYYLOQNVGIH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|