C23H26N2O3 — CID 89153226
(E)-3-(4-tert-butylphenyl)-N-(2-formyl-4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)prop-2-enamide (PubChem CID 89153226) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(2-formyl-4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(2-formyl-4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 89153226 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(2-formyl-4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)prop-2-enamide |
| SMILES | CN1CC(C=O)Oc2ccc(NC(=O)/C=C/c3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C23H26N2O3/c1-23(2,3)17-8-5-16(6-9-17)7-12-22(27)24-18-10-11-21-20(13-18)25(4)14-19(15-26)28-21/h5-13,15,19H,14H2,1-4H3,(H,24,27)/b12-7+ |
| InChIKey | ORUOKGNVZGYTLL-KPKJPENVSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|