C24H31N3O2 — CID 76617158
3-(4-tert-butylphenyl)-N-[2-[(dimethylamino)methyl]-3,4-dihydro-2H-1,4-benzoxazin-6-yl]prop-2-enamide (PubChem CID 76617158) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[2-[(dimethylamino)methyl]-3,4-dihydro-2H-1,4-benzoxazin-6-yl]prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[2-[(dimethylamino)methyl]-3,4-dihydro-2H-1,4-benzoxazin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76617158 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[2-[(dimethylamino)methyl]-3,4-dihydro-2H-1,4-benzoxazin-6-yl]prop-2-enamide |
| SMILES | CN(C)CC1CNc2cc(NC(=O)C=Cc3ccc(C(C)(C)C)cc3)ccc2O1 |
| InChI | InChI=1S/C24H31N3O2/c1-24(2,3)18-9-6-17(7-10-18)8-13-23(28)26-19-11-12-22-21(14-19)25-15-20(29-22)16-27(4)5/h6-14,20,25H,15-16H2,1-5H3,(H,26,28) |
| InChIKey | OWIBWVSXHMCBLI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|