C26H28ClN3O2 — CID 176996941
6-[[1-but-2-ynoyl-3-(3-chloro-2-methylphenyl)pyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one (PubChem CID 176996941) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 6-[[1-but-2-ynoyl-3-(3-chloro-2-methylphenyl)pyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one.
| Compound Name | 6-[[1-but-2-ynoyl-3-(3-chloro-2-methylphenyl)pyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 176996941 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 6-[[1-but-2-ynoyl-3-(3-chloro-2-methylphenyl)pyrrolidin-3-yl]amino]-1,3,3-trimethylindol-2-one |
| SMILES | CC#CC(=O)N1CCC(Nc2ccc3c(c2)N(C)C(=O)C3(C)C)(c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C26H28ClN3O2/c1-6-8-23(31)30-14-13-26(16-30,19-9-7-10-21(27)17(19)2)28-18-11-12-20-22(15-18)29(5)24(32)25(20,3)4/h7,9-12,15,28H,13-14,16H2,1-5H3 |
| InChIKey | DSGVQSZIUABNJT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|