C18H23N3O2 — CID 176997011
1,3,3-trimethyl-6-[(1-prop-2-enoylpyrrolidin-3-yl)amino]indol-2-one (PubChem CID 176997011) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-[(1-prop-2-enoylpyrrolidin-3-yl)amino]indol-2-one.
| Compound Name | 1,3,3-trimethyl-6-[(1-prop-2-enoylpyrrolidin-3-yl)amino]indol-2-one |
|---|---|
| PubChem CID | 176997011 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1,3,3-trimethyl-6-[(1-prop-2-enoylpyrrolidin-3-yl)amino]indol-2-one |
| SMILES | C=CC(=O)N1CCC(Nc2ccc3c(c2)N(C)C(=O)C3(C)C)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-5-16(22)21-9-8-13(11-21)19-12-6-7-14-15(10-12)20(4)17(23)18(14,2)3/h5-7,10,13,19H,1,8-9,11H2,2-4H3 |
| InChIKey | WHMXMJFQRSWLKL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|