C23H26Cl2FN5O2 — CID 176997283
2-[1-[2-amino-4-[(1-prop-2-enoylpyrrolidin-3-yl)amino]phenyl]ethylideneamino]acetamide;1,2-dichloro-4-fluorobenzene (PubChem CID 176997283) has the molecular formula C23H26Cl2FN5O2 and a molecular weight of 494.40 g/mol. Its IUPAC name is 2-[1-[2-amino-4-[(1-prop-2-enoylpyrrolidin-3-yl)amino]phenyl]ethylideneamino]acetamide;1,2-dichloro-4-fluorobenzene.
| Compound Name | 2-[1-[2-amino-4-[(1-prop-2-enoylpyrrolidin-3-yl)amino]phenyl]ethylideneamino]acetamide;1,2-dichloro-4-fluorobenzene |
|---|---|
| PubChem CID | 176997283 |
| Molecular Formula | C23H26Cl2FN5O2 |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[1-[2-amino-4-[(1-prop-2-enoylpyrrolidin-3-yl)amino]phenyl]ethylideneamino]acetamide;1,2-dichloro-4-fluorobenzene |
| SMILES | C=CC(=O)N1CCC(Nc2ccc(/C(C)=N/CC(N)=O)c(N)c2)C1.Fc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H23N5O2.C6H3Cl2F/c1-3-17(24)22-7-6-13(10-22)21-12-4-5-14(15(18)8-12)11(2)20-9-16(19)23;7-5-2-1-4(9)3-6(5)8/h3-5,8,13,21H,1,6-7,9-10,18H2,2H3,(H2,19,23);1-3H/b20-11+; |
| InChIKey | NEGPXZGYWODFNO-DOELHFPHSA-N |
| XLogP | 3.89 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|