C21H23Cl2FN4O — CID 176997262
1,2-dichloro-4-fluorobenzene;1-[3-[[(6Z)-6-ethylidene-1-(methylideneamino)-3-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 176997262) has the molecular formula C21H23Cl2FN4O and a molecular weight of 437.35 g/mol. Its IUPAC name is 1,2-dichloro-4-fluorobenzene;1-[3-[[(6Z)-6-ethylidene-1-(methylideneamino)-3-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1,2-dichloro-4-fluorobenzene;1-[3-[[(6Z)-6-ethylidene-1-(methylideneamino)-3-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176997262 |
| Molecular Formula | C21H23Cl2FN4O |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1,2-dichloro-4-fluorobenzene;1-[3-[[(6Z)-6-ethylidene-1-(methylideneamino)-3-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(NC2=CN(N=C)/C(=C\C)C=C2)C1.Fc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20N4O.C6H3Cl2F/c1-4-14-7-6-12(11-19(14)16-3)17-13-8-9-18(10-13)15(20)5-2;7-5-2-1-4(9)3-6(5)8/h4-7,11,13,17H,2-3,8-10H2,1H3;1-3H/b14-4-; |
| InChIKey | OLBMLHMVLBBLGG-CYBPKNTASA-N |
| XLogP | 4.73 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|