C15H17N3O2 — CID 176996795
N-[[(1'-methyl-2'-oxospiro[cyclopropane-1,3'-indole]-6'-yl)amino]methyl]prop-2-enamide (PubChem CID 176996795) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[[(1'-methyl-2'-oxospiro[cyclopropane-1,3'-indole]-6'-yl)amino]methyl]prop-2-enamide.
| Compound Name | N-[[(1'-methyl-2'-oxospiro[cyclopropane-1,3'-indole]-6'-yl)amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 176996795 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-[[(1'-methyl-2'-oxospiro[cyclopropane-1,3'-indole]-6'-yl)amino]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCNc1ccc2c(c1)N(C)C(=O)C21CC1 |
| InChI | InChI=1S/C15H17N3O2/c1-3-13(19)17-9-16-10-4-5-11-12(8-10)18(2)14(20)15(11)6-7-15/h3-5,8,16H,1,6-7,9H2,2H3,(H,17,19) |
| InChIKey | DTRZVKLLXHQXLQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|