C14H16N2O4 — CID 146524669
(1-methyl-2-oxospiro[indole-3,4'-oxane]-6-yl)carbamic acid (PubChem CID 146524669) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1-methyl-2-oxospiro[indole-3,4'-oxane]-6-yl)carbamic acid.
| Compound Name | (1-methyl-2-oxospiro[indole-3,4'-oxane]-6-yl)carbamic acid |
|---|---|
| PubChem CID | 146524669 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (1-methyl-2-oxospiro[indole-3,4'-oxane]-6-yl)carbamic acid |
| SMILES | CN1C(=O)C2(CCOCC2)c2ccc(NC(=O)O)cc21 |
| InChI | InChI=1S/C14H16N2O4/c1-16-11-8-9(15-13(18)19)2-3-10(11)14(12(16)17)4-6-20-7-5-14/h2-3,8,15H,4-7H2,1H3,(H,18,19) |
| InChIKey | KZJSAHISYGQFON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |