C19H24N4O4 — CID 155869129
formic acid;1-methyl-5-[(1-methylpyrazol-4-yl)methylamino]spiro[indole-3,4'-oxane]-2-one (PubChem CID 155869129) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is formic acid;1-methyl-5-[(1-methylpyrazol-4-yl)methylamino]spiro[indole-3,4'-oxane]-2-one.
| Compound Name | formic acid;1-methyl-5-[(1-methylpyrazol-4-yl)methylamino]spiro[indole-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 155869129 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | formic acid;1-methyl-5-[(1-methylpyrazol-4-yl)methylamino]spiro[indole-3,4'-oxane]-2-one |
| SMILES | CN1C(=O)C2(CCOCC2)c2cc(NCc3cnn(C)c3)ccc21.O=CO |
| InChI | InChI=1S/C18H22N4O2.CH2O2/c1-21-12-13(11-20-21)10-19-14-3-4-16-15(9-14)18(17(23)22(16)2)5-7-24-8-6-18;2-1-3/h3-4,9,11-12,19H,5-8,10H2,1-2H3;1H,(H,2,3) |
| InChIKey | VWPXOJKJDLLLQB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|